About [(2R)-8-iodo-3,4-dihydro-2H-chromen-2-yl]methanol
[(2R)-8-iodo-3,4-dihydro-2H-chromen-2-yl]methanol (PubChem CID 71056694) has the molecular formula C10H11IO2
and a molecular weight of 290.10 g/mol. Its IUPAC name is [(2R)-8-iodo-3,4-dihydro-2H-chromen-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-8-iodo-3,4-dihydro-2H-chromen-2-yl]methanol |
| PubChem CID | 71056694 |
| Molecular Formula | C10H11IO2 |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | [(2R)-8-iodo-3,4-dihydro-2H-chromen-2-yl]methanol |
| SMILES | OC[C@H]1CCc2cccc(I)c2O1 |
| InChI | InChI=1S/C10H11IO2/c11-9-3-1-2-7-4-5-8(6-12)13-10(7)9/h1-3,8,12H,4-6H2/t8-/m1/s1 |
| InChIKey | JWMBRZNRHJKKQX-MRVPVSSYSA-N |
| XLogP | 1.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-8-iodo-3,4-dihydro-2H-chromen-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-8-iodo-3,4-dihydro-2H-chromen-2-yl]methanol?
The IUPAC name of [(2R)-8-iodo-3,4-dihydro-2H-chromen-2-yl]methanol (CID 71056694) is [(2R)-8-iodo-3,4-dihydro-2H-chromen-2-yl]methanol.
What is the SMILES notation for [(2R)-8-iodo-3,4-dihydro-2H-chromen-2-yl]methanol?
The canonical SMILES for [(2R)-8-iodo-3,4-dihydro-2H-chromen-2-yl]methanol is OC[C@H]1CCc2cccc(I)c2O1.
What is the InChIKey of [(2R)-8-iodo-3,4-dihydro-2H-chromen-2-yl]methanol?
The InChIKey is JWMBRZNRHJKKQX-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H11IO2/c11-9-3-1-2-7-4-5-8(6-12)13-10(7)9/h1-3,8,12H,4-6H2/t8-/m1/s1.
What are the key properties of [(2R)-8-iodo-3,4-dihydro-2H-chromen-2-yl]methanol?
[(2R)-8-iodo-3,4-dihydro-2H-chromen-2-yl]methanol has a molecular weight of 290.10 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-8-iodo-3,4-dihydro-2H-chromen-2-yl]methanol is sourced from PubChem (CID 71056694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).