About [7-(3-aminopropyl)-2,3-dihydro-1-benzofuran-2-yl]methanol
[7-(3-aminopropyl)-2,3-dihydro-1-benzofuran-2-yl]methanol (PubChem CID 71056794) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is [7-(3-aminopropyl)-2,3-dihydro-1-benzofuran-2-yl]methanol.
Molecular Properties
| Compound Name | [7-(3-aminopropyl)-2,3-dihydro-1-benzofuran-2-yl]methanol |
| PubChem CID | 71056794 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | [7-(3-aminopropyl)-2,3-dihydro-1-benzofuran-2-yl]methanol |
| SMILES | NCCCc1cccc2c1OC(CO)C2 |
| InChI | InChI=1S/C12H17NO2/c13-6-2-5-9-3-1-4-10-7-11(8-14)15-12(9)10/h1,3-4,11,14H,2,5-8,13H2 |
| InChIKey | LLLVRYZMBCYTJQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [7-(3-aminopropyl)-2,3-dihydro-1-benzofuran-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(3-aminopropyl)-2,3-dihydro-1-benzofuran-2-yl]methanol?
The IUPAC name of [7-(3-aminopropyl)-2,3-dihydro-1-benzofuran-2-yl]methanol (CID 71056794) is [7-(3-aminopropyl)-2,3-dihydro-1-benzofuran-2-yl]methanol.
What is the SMILES notation for [7-(3-aminopropyl)-2,3-dihydro-1-benzofuran-2-yl]methanol?
The canonical SMILES for [7-(3-aminopropyl)-2,3-dihydro-1-benzofuran-2-yl]methanol is NCCCc1cccc2c1OC(CO)C2.
What is the InChIKey of [7-(3-aminopropyl)-2,3-dihydro-1-benzofuran-2-yl]methanol?
The InChIKey is LLLVRYZMBCYTJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c13-6-2-5-9-3-1-4-10-7-11(8-14)15-12(9)10/h1,3-4,11,14H,2,5-8,13H2.
What are the key properties of [7-(3-aminopropyl)-2,3-dihydro-1-benzofuran-2-yl]methanol?
[7-(3-aminopropyl)-2,3-dihydro-1-benzofuran-2-yl]methanol has a molecular weight of 207.27 g/mol, XLogP of 0.87, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(3-aminopropyl)-2,3-dihydro-1-benzofuran-2-yl]methanol is sourced from PubChem (CID 71056794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).