C30H45F3O3 — CID 71056812
[(1S,3R,8R,12S,15R)-7,7,12,16-tetramethyl-15-[(2R)-6,6,6-trifluoro-5-oxohexan-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate (PubChem CID 71056812) has the molecular formula C30H45F3O3 and a molecular weight of 510.68 g/mol. Its IUPAC name is [(1S,3R,8R,12S,15R)-7,7,12,16-tetramethyl-15-[(2R)-6,6,6-trifluoro-5-oxohexan-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate.
| Compound Name | [(1S,3R,8R,12S,15R)-7,7,12,16-tetramethyl-15-[(2R)-6,6,6-trifluoro-5-oxohexan-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate |
|---|---|
| PubChem CID | 71056812 |
| Molecular Formula | C30H45F3O3 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | [(1S,3R,8R,12S,15R)-7,7,12,16-tetramethyl-15-[(2R)-6,6,6-trifluoro-5-oxohexan-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate |
| SMILES | CC(=O)OC1CC[C@]23C[C@]24CCC2(C)[C@@H]([C@H](C)CCC(=O)C(F)(F)F)CC[C@@]2(C)C4CC[C@H]3C1(C)C |
| InChI | InChI=1S/C30H45F3O3/c1-18(7-10-23(35)30(31,32)33)20-11-13-27(6)22-9-8-21-25(3,4)24(36-19(2)34)12-14-28(21)17-29(22,28)16-15-26(20,27)5/h18,20-22,24H,7-17H2,1-6H3/t18-,20-,21+,22?,24?,26?,27+,28-,29+/m1/s1 |
| InChIKey | AYTAIJBUBKDOCH-HAVVRQOSSA-N |
| XLogP | 7.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |