About N-[4-(methylsulfamoyl)cyclohexa-1,3-dien-1-yl]acetamide
N-[4-(methylsulfamoyl)cyclohexa-1,3-dien-1-yl]acetamide (PubChem CID 71056827) has the molecular formula C9H14N2O3S
and a molecular weight of 230.29 g/mol. Its IUPAC name is N-[4-(methylsulfamoyl)cyclohexa-1,3-dien-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[4-(methylsulfamoyl)cyclohexa-1,3-dien-1-yl]acetamide |
| PubChem CID | 71056827 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | N-[4-(methylsulfamoyl)cyclohexa-1,3-dien-1-yl]acetamide |
| SMILES | CNS(=O)(=O)C1=CC=C(NC(C)=O)CC1 |
| InChI | InChI=1S/C9H14N2O3S/c1-7(12)11-8-3-5-9(6-4-8)15(13,14)10-2/h3,5,10H,4,6H2,1-2H3,(H,11,12) |
| InChIKey | KZYRTUQWUHUAGN-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-(methylsulfamoyl)cyclohexa-1,3-dien-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(methylsulfamoyl)cyclohexa-1,3-dien-1-yl]acetamide?
The IUPAC name of N-[4-(methylsulfamoyl)cyclohexa-1,3-dien-1-yl]acetamide (CID 71056827) is N-[4-(methylsulfamoyl)cyclohexa-1,3-dien-1-yl]acetamide.
What is the SMILES notation for N-[4-(methylsulfamoyl)cyclohexa-1,3-dien-1-yl]acetamide?
The canonical SMILES for N-[4-(methylsulfamoyl)cyclohexa-1,3-dien-1-yl]acetamide is CNS(=O)(=O)C1=CC=C(NC(C)=O)CC1.
What is the InChIKey of N-[4-(methylsulfamoyl)cyclohexa-1,3-dien-1-yl]acetamide?
The InChIKey is KZYRTUQWUHUAGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3S/c1-7(12)11-8-3-5-9(6-4-8)15(13,14)10-2/h3,5,10H,4,6H2,1-2H3,(H,11,12).
What are the key properties of N-[4-(methylsulfamoyl)cyclohexa-1,3-dien-1-yl]acetamide?
N-[4-(methylsulfamoyl)cyclohexa-1,3-dien-1-yl]acetamide has a molecular weight of 230.29 g/mol, XLogP of 0.23, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(methylsulfamoyl)cyclohexa-1,3-dien-1-yl]acetamide is sourced from PubChem (CID 71056827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).