C19H21NO4 — CID 71057053
(10R,11S,13S,16R,17S)-17-acetyl-13-methoxy-15-methyl-14-oxa-1-azatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,8-tetraen-12-one (PubChem CID 71057053) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (10R,11S,13S,16R,17S)-17-acetyl-13-methoxy-15-methyl-14-oxa-1-azatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,8-tetraen-12-one.
| Compound Name | (10R,11S,13S,16R,17S)-17-acetyl-13-methoxy-15-methyl-14-oxa-1-azatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 71057053 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (10R,11S,13S,16R,17S)-17-acetyl-13-methoxy-15-methyl-14-oxa-1-azatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,8-tetraen-12-one |
| SMILES | CO[C@H]1OC(C)[C@@H]2[C@H](C1=O)[C@H]1C=Cc3ccccc3N1[C@@H]2C(C)=O |
| InChI | InChI=1S/C19H21NO4/c1-10(21)17-15-11(2)24-19(23-3)18(22)16(15)14-9-8-12-6-4-5-7-13(12)20(14)17/h4-9,11,14-17,19H,1-3H3/t11?,14-,15-,16-,17-,19+/m1/s1 |
| InChIKey | AEDXWCXNJMBPBQ-CCKPKMAASA-N |
| XLogP | 2.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |