C25H17F4N3OS — CID 71057133
5-(2-fluoro-4-pyridinyl)-1-[4-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]thiophen-2-yl]benzimidazole (PubChem CID 71057133) has the molecular formula C25H17F4N3OS and a molecular weight of 483.49 g/mol. Its IUPAC name is 5-(2-fluoro-4-pyridinyl)-1-[4-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]thiophen-2-yl]benzimidazole.
| Compound Name | 5-(2-fluoro-4-pyridinyl)-1-[4-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]thiophen-2-yl]benzimidazole |
|---|---|
| PubChem CID | 71057133 |
| Molecular Formula | C25H17F4N3OS |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 5-(2-fluoro-4-pyridinyl)-1-[4-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]thiophen-2-yl]benzimidazole |
| SMILES | C[C@@H](Oc1csc(-n2cnc3cc(-c4ccnc(F)c4)ccc32)c1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C25H17F4N3OS/c1-15(19-4-2-3-5-20(19)25(27,28)29)33-18-12-24(34-13-18)32-14-31-21-10-16(6-7-22(21)32)17-8-9-30-23(26)11-17/h2-15H,1H3/t15-/m1/s1 |
| InChIKey | ONHPGIXHSGQAAO-OAHLLOKOSA-N |
| XLogP | 7.45 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|