C42H65NO6S — CID 71057539
N-[2-[4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2-[(2S,4R)-2,3,4-tributoxy-5-(butoxymethyl)cyclohexyl]phenoxy]ethyl]acetamide (PubChem CID 71057539) has the molecular formula C42H65NO6S and a molecular weight of 712.05 g/mol. Its IUPAC name is N-[2-[4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2-[(2S,4R)-2,3,4-tributoxy-5-(butoxymethyl)cyclohexyl]phenoxy]ethyl]acetamide.
| Compound Name | N-[2-[4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2-[(2S,4R)-2,3,4-tributoxy-5-(butoxymethyl)cyclohexyl]phenoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 71057539 |
| Molecular Formula | C42H65NO6S |
| Molecular Weight | 712.05 g/mol |
| Exact Mass | 711.45 |
| IUPAC Name | N-[2-[4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2-[(2S,4R)-2,3,4-tributoxy-5-(butoxymethyl)cyclohexyl]phenoxy]ethyl]acetamide |
| SMILES | CCCCOCC1CC(c2cc(CC3Cc4ccccc4S3)ccc2OCCNC(C)=O)[C@H](OCCCC)C(OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C42H65NO6S/c1-6-10-21-45-30-34-29-37(41(48-23-12-8-3)42(49-24-13-9-4)40(34)47-22-11-7-2)36-27-32(18-19-38(36)46-25-20-43-31(5)44)26-35-28-33-16-14-15-17-39(33)50-35/h14-19,27,34-35,37,40-42H,6-13,20-26,28-30H2,1-5H3,(H,43,44)/t34?,35?,37?,40-,41+,42?/m1/s1 |
| InChIKey | DVAWIDFTZBDFGG-BEIHEBJTSA-N |
| XLogP | 8.94 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.05 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|