C34H56O6S — CID 71057677
(3R,5R,6R)-3,4,5-tributoxy-2-(butoxymethyl)-6-[(3R)-3-[(4-methoxyphenyl)methyl]-2,3-dihydrothiophen-5-yl]oxane (PubChem CID 71057677) has the molecular formula C34H56O6S and a molecular weight of 592.88 g/mol. Its IUPAC name is (3R,5R,6R)-3,4,5-tributoxy-2-(butoxymethyl)-6-[(3R)-3-[(4-methoxyphenyl)methyl]-2,3-dihydrothiophen-5-yl]oxane.
| Compound Name | (3R,5R,6R)-3,4,5-tributoxy-2-(butoxymethyl)-6-[(3R)-3-[(4-methoxyphenyl)methyl]-2,3-dihydrothiophen-5-yl]oxane |
|---|---|
| PubChem CID | 71057677 |
| Molecular Formula | C34H56O6S |
| Molecular Weight | 592.88 g/mol |
| Exact Mass | 592.38 |
| IUPAC Name | (3R,5R,6R)-3,4,5-tributoxy-2-(butoxymethyl)-6-[(3R)-3-[(4-methoxyphenyl)methyl]-2,3-dihydrothiophen-5-yl]oxane |
| SMILES | CCCCOCC1O[C@@H](C2=C[C@@H](Cc3ccc(OC)cc3)CS2)C(OCCCC)C(OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C34H56O6S/c1-6-10-18-36-24-29-31(37-19-11-7-2)33(38-20-12-8-3)34(39-21-13-9-4)32(40-29)30-23-27(25-41-30)22-26-14-16-28(35-5)17-15-26/h14-17,23,27,29,31-34H,6-13,18-22,24-25H2,1-5H3/t27-,29?,31-,32+,33?,34?/m1/s1 |
| InChIKey | ZAYHOZOLUHVVHK-UAOMHLJFSA-N |
| XLogP | 7.62 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.88 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|