C33H49FO5S — CID 71057781
[(2R,3R,5S)-3,4,5-tributoxy-6-[5-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluorocyclohexa-1,3-dien-1-yl]oxan-2-yl]methanol (PubChem CID 71057781) has the molecular formula C33H49FO5S and a molecular weight of 576.82 g/mol. Its IUPAC name is [(2R,3R,5S)-3,4,5-tributoxy-6-[5-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluorocyclohexa-1,3-dien-1-yl]oxan-2-yl]methanol.
| Compound Name | [(2R,3R,5S)-3,4,5-tributoxy-6-[5-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluorocyclohexa-1,3-dien-1-yl]oxan-2-yl]methanol |
|---|---|
| PubChem CID | 71057781 |
| Molecular Formula | C33H49FO5S |
| Molecular Weight | 576.82 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | [(2R,3R,5S)-3,4,5-tributoxy-6-[5-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluorocyclohexa-1,3-dien-1-yl]oxan-2-yl]methanol |
| SMILES | CCCCOC1[C@@H](OCCCC)C(C2=CC=C(F)C(CC3Cc4ccccc4S3)C2)O[C@H](CO)[C@H]1OCCCC |
| InChI | InChI=1S/C33H49FO5S/c1-4-7-16-36-31-28(22-35)39-30(32(37-17-8-5-2)33(31)38-18-9-6-3)24-14-15-27(34)25(19-24)21-26-20-23-12-10-11-13-29(23)40-26/h10-15,25-26,28,30-33,35H,4-9,16-22H2,1-3H3/t25?,26?,28-,30?,31-,32+,33?/m1/s1 |
| InChIKey | CDIYEDWUNWZTTB-GSFVGSLLSA-N |
| XLogP | 7.21 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.82 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|