C24H44N10O3 — CID 71058346
(2R)-1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-N-[[1-[3-[ethyl-(methyldiazenyl)amino]propyl]triazol-4-yl]methyl]pyrrolidine-2-carboxamide (PubChem CID 71058346) has the molecular formula C24H44N10O3 and a molecular weight of 520.68 g/mol. Its IUPAC name is (2R)-1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-N-[[1-[3-[ethyl-(methyldiazenyl)amino]propyl]triazol-4-yl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-N-[[1-[3-[ethyl-(methyldiazenyl)amino]propyl]triazol-4-yl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 71058346 |
| Molecular Formula | C24H44N10O3 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | (2R)-1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-N-[[1-[3-[ethyl-(methyldiazenyl)amino]propyl]triazol-4-yl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CCN(CCCn1cc(CNC(=O)[C@H]2CCCN2C(=O)[C@@H](NC(=O)[C@H](C)NC)C(C)(C)C)nn1)/N=N/C |
| InChI | InChI=1S/C24H44N10O3/c1-8-32(30-26-7)12-10-13-33-16-18(29-31-33)15-27-22(36)19-11-9-14-34(19)23(37)20(24(3,4)5)28-21(35)17(2)25-6/h16-17,19-20,25H,8-15H2,1-7H3,(H,27,36)(H,28,35)/b30-26+/t17-,19+,20+/m0/s1 |
| InChIKey | BYAULVJZHYHBRT-XTCXOOBGSA-N |
| XLogP | 0.73 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|