About methyl (2S)-3-(3,7-dimethylpyrazolo[1,5-a]pyrimidin-5-yl)-2-methylpropanoate
methyl (2S)-3-(3,7-dimethylpyrazolo[1,5-a]pyrimidin-5-yl)-2-methylpropanoate (PubChem CID 71058350) has the molecular formula C13H17N3O2
and a molecular weight of 247.30 g/mol. Its IUPAC name is methyl (2S)-3-(3,7-dimethylpyrazolo[1,5-a]pyrimidin-5-yl)-2-methylpropanoate.
Molecular Properties
| Compound Name | methyl (2S)-3-(3,7-dimethylpyrazolo[1,5-a]pyrimidin-5-yl)-2-methylpropanoate |
| PubChem CID | 71058350 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | methyl (2S)-3-(3,7-dimethylpyrazolo[1,5-a]pyrimidin-5-yl)-2-methylpropanoate |
| SMILES | COC(=O)[C@@H](C)Cc1cc(C)n2ncc(C)c2n1 |
| InChI | InChI=1S/C13H17N3O2/c1-8(13(17)18-4)5-11-6-10(3)16-12(15-11)9(2)7-14-16/h6-8H,5H2,1-4H3/t8-/m0/s1 |
| InChIKey | ZHCQGWPFBQMQIH-QMMMGPOBSA-N |
| XLogP | 1.70 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2S)-3-(3,7-dimethylpyrazolo[1,5-a]pyrimidin-5-yl)-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-3-(3,7-dimethylpyrazolo[1,5-a]pyrimidin-5-yl)-2-methylpropanoate?
The IUPAC name of methyl (2S)-3-(3,7-dimethylpyrazolo[1,5-a]pyrimidin-5-yl)-2-methylpropanoate (CID 71058350) is methyl (2S)-3-(3,7-dimethylpyrazolo[1,5-a]pyrimidin-5-yl)-2-methylpropanoate.
What is the SMILES notation for methyl (2S)-3-(3,7-dimethylpyrazolo[1,5-a]pyrimidin-5-yl)-2-methylpropanoate?
The canonical SMILES for methyl (2S)-3-(3,7-dimethylpyrazolo[1,5-a]pyrimidin-5-yl)-2-methylpropanoate is COC(=O)[C@@H](C)Cc1cc(C)n2ncc(C)c2n1.
What is the InChIKey of methyl (2S)-3-(3,7-dimethylpyrazolo[1,5-a]pyrimidin-5-yl)-2-methylpropanoate?
The InChIKey is ZHCQGWPFBQMQIH-QMMMGPOBSA-N. The full InChI is InChI=1S/C13H17N3O2/c1-8(13(17)18-4)5-11-6-10(3)16-12(15-11)9(2)7-14-16/h6-8H,5H2,1-4H3/t8-/m0/s1.
What are the key properties of methyl (2S)-3-(3,7-dimethylpyrazolo[1,5-a]pyrimidin-5-yl)-2-methylpropanoate?
methyl (2S)-3-(3,7-dimethylpyrazolo[1,5-a]pyrimidin-5-yl)-2-methylpropanoate has a molecular weight of 247.30 g/mol, XLogP of 1.70, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-3-(3,7-dimethylpyrazolo[1,5-a]pyrimidin-5-yl)-2-methylpropanoate is sourced from PubChem (CID 71058350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).