About (2R)-3-(hydroxymethyl)-5-[(1S)-1-hydroxy-2-methylpropyl]cyclopentane-1,2,4-triol
(2R)-3-(hydroxymethyl)-5-[(1S)-1-hydroxy-2-methylpropyl]cyclopentane-1,2,4-triol (PubChem CID 71058447) has the molecular formula C10H20O5
and a molecular weight of 220.26 g/mol. Its IUPAC name is (2R)-3-(hydroxymethyl)-5-[(1S)-1-hydroxy-2-methylpropyl]cyclopentane-1,2,4-triol.
Molecular Properties
| Compound Name | (2R)-3-(hydroxymethyl)-5-[(1S)-1-hydroxy-2-methylpropyl]cyclopentane-1,2,4-triol |
| PubChem CID | 71058447 |
| Molecular Formula | C10H20O5 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (2R)-3-(hydroxymethyl)-5-[(1S)-1-hydroxy-2-methylpropyl]cyclopentane-1,2,4-triol |
| SMILES | CC(C)C(O)C1C(O)C(CO)[C@@H](O)C1O |
| InChI | InChI=1S/C10H20O5/c1-4(2)7(12)6-8(13)5(3-11)9(14)10(6)15/h4-15H,3H2,1-2H3/t5?,6?,7?,8?,9-,10?/m1/s1 |
| InChIKey | IHDJDIFRJDDVQW-IQCGIJLJSA-N |
| XLogP | -1.68 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-3-(hydroxymethyl)-5-[(1S)-1-hydroxy-2-methylpropyl]cyclopentane-1,2,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-(hydroxymethyl)-5-[(1S)-1-hydroxy-2-methylpropyl]cyclopentane-1,2,4-triol?
The IUPAC name of (2R)-3-(hydroxymethyl)-5-[(1S)-1-hydroxy-2-methylpropyl]cyclopentane-1,2,4-triol (CID 71058447) is (2R)-3-(hydroxymethyl)-5-[(1S)-1-hydroxy-2-methylpropyl]cyclopentane-1,2,4-triol.
What is the SMILES notation for (2R)-3-(hydroxymethyl)-5-[(1S)-1-hydroxy-2-methylpropyl]cyclopentane-1,2,4-triol?
The canonical SMILES for (2R)-3-(hydroxymethyl)-5-[(1S)-1-hydroxy-2-methylpropyl]cyclopentane-1,2,4-triol is CC(C)C(O)C1C(O)C(CO)[C@@H](O)C1O.
What is the InChIKey of (2R)-3-(hydroxymethyl)-5-[(1S)-1-hydroxy-2-methylpropyl]cyclopentane-1,2,4-triol?
The InChIKey is IHDJDIFRJDDVQW-IQCGIJLJSA-N. The full InChI is InChI=1S/C10H20O5/c1-4(2)7(12)6-8(13)5(3-11)9(14)10(6)15/h4-15H,3H2,1-2H3/t5?,6?,7?,8?,9-,10?/m1/s1.
What are the key properties of (2R)-3-(hydroxymethyl)-5-[(1S)-1-hydroxy-2-methylpropyl]cyclopentane-1,2,4-triol?
(2R)-3-(hydroxymethyl)-5-[(1S)-1-hydroxy-2-methylpropyl]cyclopentane-1,2,4-triol has a molecular weight of 220.26 g/mol, XLogP of -1.68, 3 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-(hydroxymethyl)-5-[(1S)-1-hydroxy-2-methylpropyl]cyclopentane-1,2,4-triol is sourced from PubChem (CID 71058447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).