C20H19N3O3 — CID 71058714
(6S)-4-naphthalen-1-yl-8-propanoyl-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 71058714) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is (6S)-4-naphthalen-1-yl-8-propanoyl-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (6S)-4-naphthalen-1-yl-8-propanoyl-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 71058714 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (6S)-4-naphthalen-1-yl-8-propanoyl-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CCC(=O)N1CC2CC1[C@H]1C(=O)N(c3cccc4ccccc34)C(=O)N21 |
| InChI | InChI=1S/C20H19N3O3/c1-2-17(24)21-11-13-10-16(21)18-19(25)23(20(26)22(13)18)15-9-5-7-12-6-3-4-8-14(12)15/h3-9,13,16,18H,2,10-11H2,1H3/t13?,16?,18-/m0/s1 |
| InChIKey | NSOPRIJAVAWLSV-AUCFXJAVSA-N |
| XLogP | 2.37 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|