C15H16FNOS — CID 71059174
N,N-diethyl-2-(4-fluorophenyl)thiophene-3-carboxamide (PubChem CID 71059174) has the molecular formula C15H16FNOS and a molecular weight of 277.36 g/mol. Its IUPAC name is N,N-diethyl-2-(4-fluorophenyl)thiophene-3-carboxamide.
| Compound Name | N,N-diethyl-2-(4-fluorophenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 71059174 |
| Molecular Formula | C15H16FNOS |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N,N-diethyl-2-(4-fluorophenyl)thiophene-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccsc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C15H16FNOS/c1-3-17(4-2)15(18)13-9-10-19-14(13)11-5-7-12(16)8-6-11/h5-10H,3-4H2,1-2H3 |
| InChIKey | UQRHFHLQCUVGPK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |