6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid

C12H6F2O2S2 — CID 71059291

IUPAC6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid
SMILESO=C(O)c1cc2c(s1)-c1cc(F)cc(F)c1SC2
InChIInChI=1S/C12H6F2O2S2/c13-6-2-7-10-5(1-9(18-10)12(15)16)4-17-11(7)8(14)3-6/h1-3H,4H2,(H,15,16)
InChIKeyLHPVICDOMVNLFF-UHFFFAOYSA-N
MW284.31 g/mol
LogP4.00
Rot. Bonds1

About 6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid

6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid (PubChem CID 71059291) has the molecular formula C12H6F2O2S2 and a molecular weight of 284.31 g/mol. Its IUPAC name is 6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid.

Molecular Properties

Compound Name6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid
PubChem CID71059291
Molecular FormulaC12H6F2O2S2
Molecular Weight284.31 g/mol
Exact Mass283.98
IUPAC Name6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid
SMILESO=C(O)c1cc2c(s1)-c1cc(F)cc(F)c1SC2
InChIInChI=1S/C12H6F2O2S2/c13-6-2-7-10-5(1-9(18-10)12(15)16)4-17-11(7)8(14)3-6/h1-3H,4H2,(H,15,16)
InChIKeyLHPVICDOMVNLFF-UHFFFAOYSA-N
XLogP4.00
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.31
LogP ≤ 54.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid?
The IUPAC name of 6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid (CID 71059291) is 6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid.
What is the SMILES notation for 6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid?
The canonical SMILES for 6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid is O=C(O)c1cc2c(s1)-c1cc(F)cc(F)c1SC2.
What is the InChIKey of 6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid?
The InChIKey is LHPVICDOMVNLFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6F2O2S2/c13-6-2-7-10-5(1-9(18-10)12(15)16)4-17-11(7)8(14)3-6/h1-3H,4H2,(H,15,16).
What are the key properties of 6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid?
6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid has a molecular weight of 284.31 g/mol, XLogP of 4.00, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-difluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid is sourced from PubChem (CID 71059291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).