About 7-chloro-4H-thieno[3,2-c]chromene
7-chloro-4H-thieno[3,2-c]chromene (PubChem CID 71059319) has the molecular formula C11H7ClOS
and a molecular weight of 222.70 g/mol. Its IUPAC name is 7-chloro-4H-thieno[3,2-c]chromene.
Molecular Properties
| Compound Name | 7-chloro-4H-thieno[3,2-c]chromene |
| PubChem CID | 71059319 |
| Molecular Formula | C11H7ClOS |
| Molecular Weight | 222.70 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | 7-chloro-4H-thieno[3,2-c]chromene |
| SMILES | Clc1ccc2c(c1)OCc1ccsc1-2 |
| InChI | InChI=1S/C11H7ClOS/c12-8-1-2-9-10(5-8)13-6-7-3-4-14-11(7)9/h1-5H,6H2 |
| InChIKey | LPHMCZAYGWJWAH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.70 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-4H-thieno[3,2-c]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4H-thieno[3,2-c]chromene?
The IUPAC name of 7-chloro-4H-thieno[3,2-c]chromene (CID 71059319) is 7-chloro-4H-thieno[3,2-c]chromene.
What is the SMILES notation for 7-chloro-4H-thieno[3,2-c]chromene?
The canonical SMILES for 7-chloro-4H-thieno[3,2-c]chromene is Clc1ccc2c(c1)OCc1ccsc1-2.
What is the InChIKey of 7-chloro-4H-thieno[3,2-c]chromene?
The InChIKey is LPHMCZAYGWJWAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClOS/c12-8-1-2-9-10(5-8)13-6-7-3-4-14-11(7)9/h1-5H,6H2.
What are the key properties of 7-chloro-4H-thieno[3,2-c]chromene?
7-chloro-4H-thieno[3,2-c]chromene has a molecular weight of 222.70 g/mol, XLogP of 3.96, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4H-thieno[3,2-c]chromene is sourced from PubChem (CID 71059319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).