About 1,3-diethyl-2-sulfanylidenepurine-6,8-dione
1,3-diethyl-2-sulfanylidenepurine-6,8-dione (PubChem CID 71060262) has the molecular formula C9H10N4O2S
and a molecular weight of 238.27 g/mol. Its IUPAC name is 1,3-diethyl-2-sulfanylidenepurine-6,8-dione.
Molecular Properties
| Compound Name | 1,3-diethyl-2-sulfanylidenepurine-6,8-dione |
| PubChem CID | 71060262 |
| Molecular Formula | C9H10N4O2S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 1,3-diethyl-2-sulfanylidenepurine-6,8-dione |
| SMILES | CCn1c(=O)c2c(n(CC)c1=S)=NC(=O)N=2 |
| InChI | InChI=1S/C9H10N4O2S/c1-3-12-6-5(10-8(15)11-6)7(14)13(4-2)9(12)16/h3-4H2,1-2H3 |
| InChIKey | QVOIKJPMVFTHDZ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 68.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diethyl-2-sulfanylidenepurine-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-2-sulfanylidenepurine-6,8-dione?
The IUPAC name of 1,3-diethyl-2-sulfanylidenepurine-6,8-dione (CID 71060262) is 1,3-diethyl-2-sulfanylidenepurine-6,8-dione.
What is the SMILES notation for 1,3-diethyl-2-sulfanylidenepurine-6,8-dione?
The canonical SMILES for 1,3-diethyl-2-sulfanylidenepurine-6,8-dione is CCn1c(=O)c2c(n(CC)c1=S)=NC(=O)N=2.
What is the InChIKey of 1,3-diethyl-2-sulfanylidenepurine-6,8-dione?
The InChIKey is QVOIKJPMVFTHDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2S/c1-3-12-6-5(10-8(15)11-6)7(14)13(4-2)9(12)16/h3-4H2,1-2H3.
What are the key properties of 1,3-diethyl-2-sulfanylidenepurine-6,8-dione?
1,3-diethyl-2-sulfanylidenepurine-6,8-dione has a molecular weight of 238.27 g/mol, XLogP of -0.21, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-2-sulfanylidenepurine-6,8-dione is sourced from PubChem (CID 71060262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).