C22H22N4O4S — CID 71060722
6-[4-[(4-carbamoyl-2-pyridin-4-yl-1,3-thiazol-5-yl)carbamoyl]phenyl]hexanoic acid (PubChem CID 71060722) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is 6-[4-[(4-carbamoyl-2-pyridin-4-yl-1,3-thiazol-5-yl)carbamoyl]phenyl]hexanoic acid.
| Compound Name | 6-[4-[(4-carbamoyl-2-pyridin-4-yl-1,3-thiazol-5-yl)carbamoyl]phenyl]hexanoic acid |
|---|---|
| PubChem CID | 71060722 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 6-[4-[(4-carbamoyl-2-pyridin-4-yl-1,3-thiazol-5-yl)carbamoyl]phenyl]hexanoic acid |
| SMILES | NC(=O)c1nc(-c2ccncc2)sc1NC(=O)c1ccc(CCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C22H22N4O4S/c23-19(29)18-22(31-21(25-18)16-10-12-24-13-11-16)26-20(30)15-8-6-14(7-9-15)4-2-1-3-5-17(27)28/h6-13H,1-5H2,(H2,23,29)(H,26,30)(H,27,28) |
| InChIKey | ZRNHKCYYWGCQLA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|