About 5-[(3,4-dimethoxybenzoyl)amino]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide
5-[(3,4-dimethoxybenzoyl)amino]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide (PubChem CID 71061044) has the molecular formula C18H16N4O4S
and a molecular weight of 384.42 g/mol. Its IUPAC name is 5-[(3,4-dimethoxybenzoyl)amino]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-[(3,4-dimethoxybenzoyl)amino]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide |
| PubChem CID | 71061044 |
| Molecular Formula | C18H16N4O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 5-[(3,4-dimethoxybenzoyl)amino]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2sc(-c3ccncc3)nc2C(N)=O)cc1OC |
| InChI | InChI=1S/C18H16N4O4S/c1-25-12-4-3-11(9-13(12)26-2)16(24)22-18-14(15(19)23)21-17(27-18)10-5-7-20-8-6-10/h3-9H,1-2H3,(H2,19,23)(H,22,24) |
| InChIKey | IOTVJVOERPUNCA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[(3,4-dimethoxybenzoyl)amino]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,4-dimethoxybenzoyl)amino]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide?
The IUPAC name of 5-[(3,4-dimethoxybenzoyl)amino]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide (CID 71061044) is 5-[(3,4-dimethoxybenzoyl)amino]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 5-[(3,4-dimethoxybenzoyl)amino]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide?
The canonical SMILES for 5-[(3,4-dimethoxybenzoyl)amino]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide is COc1ccc(C(=O)Nc2sc(-c3ccncc3)nc2C(N)=O)cc1OC.
What is the InChIKey of 5-[(3,4-dimethoxybenzoyl)amino]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide?
The InChIKey is IOTVJVOERPUNCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4O4S/c1-25-12-4-3-11(9-13(12)26-2)16(24)22-18-14(15(19)23)21-17(27-18)10-5-7-20-8-6-10/h3-9H,1-2H3,(H2,19,23)(H,22,24).
What are the key properties of 5-[(3,4-dimethoxybenzoyl)amino]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide?
5-[(3,4-dimethoxybenzoyl)amino]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide has a molecular weight of 384.42 g/mol, XLogP of 2.57, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-dimethoxybenzoyl)amino]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 71061044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).