About (3-bromo-8,9-dihydro-7H-benzo[7]annulen-6-yl)methanol
(3-bromo-8,9-dihydro-7H-benzo[7]annulen-6-yl)methanol (PubChem CID 71061309) has the molecular formula C12H13BrO
and a molecular weight of 253.14 g/mol. Its IUPAC name is (3-bromo-8,9-dihydro-7H-benzo[7]annulen-6-yl)methanol.
Molecular Properties
| Compound Name | (3-bromo-8,9-dihydro-7H-benzo[7]annulen-6-yl)methanol |
| PubChem CID | 71061309 |
| Molecular Formula | C12H13BrO |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | (3-bromo-8,9-dihydro-7H-benzo[7]annulen-6-yl)methanol |
| SMILES | OCC1=Cc2cc(Br)ccc2CCC1 |
| InChI | InChI=1S/C12H13BrO/c13-12-5-4-10-3-1-2-9(8-14)6-11(10)7-12/h4-7,14H,1-3,8H2 |
| InChIKey | FEONLBVSUGEZHE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-bromo-8,9-dihydro-7H-benzo[7]annulen-6-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-8,9-dihydro-7H-benzo[7]annulen-6-yl)methanol?
The IUPAC name of (3-bromo-8,9-dihydro-7H-benzo[7]annulen-6-yl)methanol (CID 71061309) is (3-bromo-8,9-dihydro-7H-benzo[7]annulen-6-yl)methanol.
What is the SMILES notation for (3-bromo-8,9-dihydro-7H-benzo[7]annulen-6-yl)methanol?
The canonical SMILES for (3-bromo-8,9-dihydro-7H-benzo[7]annulen-6-yl)methanol is OCC1=Cc2cc(Br)ccc2CCC1.
What is the InChIKey of (3-bromo-8,9-dihydro-7H-benzo[7]annulen-6-yl)methanol?
The InChIKey is FEONLBVSUGEZHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrO/c13-12-5-4-10-3-1-2-9(8-14)6-11(10)7-12/h4-7,14H,1-3,8H2.
What are the key properties of (3-bromo-8,9-dihydro-7H-benzo[7]annulen-6-yl)methanol?
(3-bromo-8,9-dihydro-7H-benzo[7]annulen-6-yl)methanol has a molecular weight of 253.14 g/mol, XLogP of 3.16, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-8,9-dihydro-7H-benzo[7]annulen-6-yl)methanol is sourced from PubChem (CID 71061309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).