C15H15F2N7O2 — CID 71062080
9-(3,3-difluoropiperidin-4-yl)-2-[(2-oxo-1H-pyridin-3-yl)amino]-7H-purin-8-one (PubChem CID 71062080) has the molecular formula C15H15F2N7O2 and a molecular weight of 363.33 g/mol. Its IUPAC name is 9-(3,3-difluoropiperidin-4-yl)-2-[(2-oxo-1H-pyridin-3-yl)amino]-7H-purin-8-one.
| Compound Name | 9-(3,3-difluoropiperidin-4-yl)-2-[(2-oxo-1H-pyridin-3-yl)amino]-7H-purin-8-one |
|---|---|
| PubChem CID | 71062080 |
| Molecular Formula | C15H15F2N7O2 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 9-(3,3-difluoropiperidin-4-yl)-2-[(2-oxo-1H-pyridin-3-yl)amino]-7H-purin-8-one |
| SMILES | O=c1[nH]cccc1Nc1ncc2[nH]c(=O)n(C3CCNCC3(F)F)c2n1 |
| InChI | InChI=1S/C15H15F2N7O2/c16-15(17)7-18-5-3-10(15)24-11-9(22-14(24)26)6-20-13(23-11)21-8-2-1-4-19-12(8)25/h1-2,4,6,10,18H,3,5,7H2,(H,19,25)(H,22,26)(H,20,21,23) |
| InChIKey | VLVFZTUFNGPTRS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |