C42H47N5O7S — CID 71062330
N,N-dibutyl-1-(2-hydroxyethyl)-2-[2-[3-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinoline-5-carbonyl]-4-(naphthalen-2-ylsulfonylcarbamoyl)phenyl]imidazole-4-carboxamide (PubChem CID 71062330) has the molecular formula C42H47N5O7S and a molecular weight of 765.93 g/mol. Its IUPAC name is N,N-dibutyl-1-(2-hydroxyethyl)-2-[2-[3-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinoline-5-carbonyl]-4-(naphthalen-2-ylsulfonylcarbamoyl)phenyl]imidazole-4-carboxamide.
| Compound Name | N,N-dibutyl-1-(2-hydroxyethyl)-2-[2-[3-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinoline-5-carbonyl]-4-(naphthalen-2-ylsulfonylcarbamoyl)phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 71062330 |
| Molecular Formula | C42H47N5O7S |
| Molecular Weight | 765.93 g/mol |
| Exact Mass | 765.32 |
| IUPAC Name | N,N-dibutyl-1-(2-hydroxyethyl)-2-[2-[3-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinoline-5-carbonyl]-4-(naphthalen-2-ylsulfonylcarbamoyl)phenyl]imidazole-4-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)c1cn(CCO)c(-c2ccc(C(=O)NS(=O)(=O)c3ccc4ccccc4c3)cc2C(=O)c2cccc3c2CC(CO)NC3)n1 |
| InChI | InChI=1S/C42H47N5O7S/c1-3-5-18-46(19-6-4-2)42(52)38-26-47(20-21-48)40(44-38)35-17-15-30(41(51)45-55(53,54)33-16-14-28-10-7-8-11-29(28)22-33)23-37(35)39(50)34-13-9-12-31-25-43-32(27-49)24-36(31)34/h7-17,22-23,26,32,43,48-49H,3-6,18-21,24-25,27H2,1-2H3,(H,45,51) |
| InChIKey | KUKSUKURPIXTKP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 170.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.93 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |