C22H24F3N5O3 — CID 71062831
4-amino-6-[1-propyl-3-(1,1,1-trifluoro-2-methoxypropan-2-yl)indol-5-yl]-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-5-one (PubChem CID 71062831) has the molecular formula C22H24F3N5O3 and a molecular weight of 463.46 g/mol. Its IUPAC name is 4-amino-6-[1-propyl-3-(1,1,1-trifluoro-2-methoxypropan-2-yl)indol-5-yl]-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-5-one.
| Compound Name | 4-amino-6-[1-propyl-3-(1,1,1-trifluoro-2-methoxypropan-2-yl)indol-5-yl]-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-5-one |
|---|---|
| PubChem CID | 71062831 |
| Molecular Formula | C22H24F3N5O3 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 4-amino-6-[1-propyl-3-(1,1,1-trifluoro-2-methoxypropan-2-yl)indol-5-yl]-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-5-one |
| SMILES | CCCn1cc(C(C)(OC)C(F)(F)F)c2cc(N3CCOc4ncnc(N)c4C3=O)ccc21 |
| InChI | InChI=1S/C22H24F3N5O3/c1-4-7-29-11-15(21(2,32-3)22(23,24)25)14-10-13(5-6-16(14)29)30-8-9-33-19-17(20(30)31)18(26)27-12-28-19/h5-6,10-12H,4,7-9H2,1-3H3,(H2,26,27,28) |
| InChIKey | KSRYYBNIICOVBV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |