C22H20F3NO5 — CID 71062840
ethyl 2-[6-(4-nitrophenyl)-1-oxo-2-(2,2,2-trifluoroethyl)-3,4-dihydronaphthalen-2-yl]acetate (PubChem CID 71062840) has the molecular formula C22H20F3NO5 and a molecular weight of 435.40 g/mol. Its IUPAC name is ethyl 2-[6-(4-nitrophenyl)-1-oxo-2-(2,2,2-trifluoroethyl)-3,4-dihydronaphthalen-2-yl]acetate.
| Compound Name | ethyl 2-[6-(4-nitrophenyl)-1-oxo-2-(2,2,2-trifluoroethyl)-3,4-dihydronaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 71062840 |
| Molecular Formula | C22H20F3NO5 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | ethyl 2-[6-(4-nitrophenyl)-1-oxo-2-(2,2,2-trifluoroethyl)-3,4-dihydronaphthalen-2-yl]acetate |
| SMILES | CCOC(=O)CC1(CC(F)(F)F)CCc2cc(-c3ccc([N+](=O)[O-])cc3)ccc2C1=O |
| InChI | InChI=1S/C22H20F3NO5/c1-2-31-19(27)12-21(13-22(23,24)25)10-9-16-11-15(5-8-18(16)20(21)28)14-3-6-17(7-4-14)26(29)30/h3-8,11H,2,9-10,12-13H2,1H3 |
| InChIKey | PDDUZGIIFUJJJI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|