C23H31F3N2 — CID 71063151
(2R)-4-[(2S,3R,4S)-2-cyclohexa-2,4-dien-1-yl-4-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutan-1-amine (PubChem CID 71063151) has the molecular formula C23H31F3N2 and a molecular weight of 392.51 g/mol. Its IUPAC name is (2R)-4-[(2S,3R,4S)-2-cyclohexa-2,4-dien-1-yl-4-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutan-1-amine.
| Compound Name | (2R)-4-[(2S,3R,4S)-2-cyclohexa-2,4-dien-1-yl-4-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 71063151 |
| Molecular Formula | C23H31F3N2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (2R)-4-[(2S,3R,4S)-2-cyclohexa-2,4-dien-1-yl-4-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutan-1-amine |
| SMILES | CC[C@@H]1c2cc(C(F)(F)F)ccc2N[C@@H](C2C=CC=CC2)[C@@H]1CC[C@@H](C)CN |
| InChI | InChI=1S/C23H31F3N2/c1-3-18-19(11-9-15(2)14-27)22(16-7-5-4-6-8-16)28-21-12-10-17(13-20(18)21)23(24,25)26/h4-7,10,12-13,15-16,18-19,22,28H,3,8-9,11,14,27H2,1-2H3/t15-,16?,18+,19-,22+/m1/s1 |
| InChIKey | COKHSVYWOSPVTD-YHSKZOQBSA-N |
| XLogP | 6.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |