About N-[4-amino-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)pentyl]oxolane-2-carboxamide
N-[4-amino-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)pentyl]oxolane-2-carboxamide (PubChem CID 71064146) has the molecular formula C20H29N5O4
and a molecular weight of 403.48 g/mol. Its IUPAC name is N-[4-amino-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)pentyl]oxolane-2-carboxamide.
Molecular Properties
| Compound Name | N-[4-amino-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)pentyl]oxolane-2-carboxamide |
| PubChem CID | 71064146 |
| Molecular Formula | C20H29N5O4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | N-[4-amino-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)pentyl]oxolane-2-carboxamide |
| SMILES | COc1cc2nc(C(C)(N)CCCNC(=O)C3CCCO3)nc(N)c2cc1OC |
| InChI | InChI=1S/C20H29N5O4/c1-20(22,7-5-8-23-18(26)14-6-4-9-29-14)19-24-13-11-16(28-3)15(27-2)10-12(13)17(21)25-19/h10-11,14H,4-9,22H2,1-3H3,(H,23,26)(H2,21,24,25) |
| InChIKey | NCPXZOZGWBBMSG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-amino-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)pentyl]oxolane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-amino-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)pentyl]oxolane-2-carboxamide?
The IUPAC name of N-[4-amino-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)pentyl]oxolane-2-carboxamide (CID 71064146) is N-[4-amino-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)pentyl]oxolane-2-carboxamide.
What is the SMILES notation for N-[4-amino-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)pentyl]oxolane-2-carboxamide?
The canonical SMILES for N-[4-amino-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)pentyl]oxolane-2-carboxamide is COc1cc2nc(C(C)(N)CCCNC(=O)C3CCCO3)nc(N)c2cc1OC.
What is the InChIKey of N-[4-amino-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)pentyl]oxolane-2-carboxamide?
The InChIKey is NCPXZOZGWBBMSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N5O4/c1-20(22,7-5-8-23-18(26)14-6-4-9-29-14)19-24-13-11-16(28-3)15(27-2)10-12(13)17(21)25-19/h10-11,14H,4-9,22H2,1-3H3,(H,23,26)(H2,21,24,25).
What are the key properties of N-[4-amino-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)pentyl]oxolane-2-carboxamide?
N-[4-amino-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)pentyl]oxolane-2-carboxamide has a molecular weight of 403.48 g/mol, XLogP of 1.48, 8 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-amino-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)pentyl]oxolane-2-carboxamide is sourced from PubChem (CID 71064146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).