C27H36N4O2 — CID 71064178
2-[methyl(nonyl)amino]-N-(2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl)acetamide (PubChem CID 71064178) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 2-[methyl(nonyl)amino]-N-(2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl)acetamide.
| Compound Name | 2-[methyl(nonyl)amino]-N-(2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl)acetamide |
|---|---|
| PubChem CID | 71064178 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 2-[methyl(nonyl)amino]-N-(2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl)acetamide |
| SMILES | CCCCCCCCCN(C)CC(=O)Nc1ccc2c(c1)CC1(C2)C(=O)Nc2ncccc21 |
| InChI | InChI=1S/C27H36N4O2/c1-3-4-5-6-7-8-9-15-31(2)19-24(32)29-22-13-12-20-17-27(18-21(20)16-22)23-11-10-14-28-25(23)30-26(27)33/h10-14,16H,3-9,15,17-19H2,1-2H3,(H,29,32)(H,28,30,33) |
| InChIKey | GUIQQZKQPDOODL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|