C19H21FN4O4 — CID 71064399
(3S,3aS)-6-(3,4-dihydroxycyclohexyl)-7-fluoro-3-(triazol-1-ylmethyl)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one (PubChem CID 71064399) has the molecular formula C19H21FN4O4 and a molecular weight of 388.40 g/mol. Its IUPAC name is (3S,3aS)-6-(3,4-dihydroxycyclohexyl)-7-fluoro-3-(triazol-1-ylmethyl)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one.
| Compound Name | (3S,3aS)-6-(3,4-dihydroxycyclohexyl)-7-fluoro-3-(triazol-1-ylmethyl)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one |
|---|---|
| PubChem CID | 71064399 |
| Molecular Formula | C19H21FN4O4 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (3S,3aS)-6-(3,4-dihydroxycyclohexyl)-7-fluoro-3-(triazol-1-ylmethyl)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one |
| SMILES | O=C1O[C@@H](Cn2ccnn2)[C@@H]2Cc3cc(C4CCC(O)C(O)C4)c(F)cc3N12 |
| InChI | InChI=1S/C19H21FN4O4/c20-13-8-14-11(5-12(13)10-1-2-16(25)17(26)7-10)6-15-18(28-19(27)24(14)15)9-23-4-3-21-22-23/h3-5,8,10,15-18,25-26H,1-2,6-7,9H2/t10?,15-,16?,17?,18-/m0/s1 |
| InChIKey | GNRDKROXJMSEQN-MAEUDCQOSA-N |
| XLogP | 1.36 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |