About N'-[[(1S,2S)-2-[[4-(ethylamino)butylamino]methyl]cyclopropyl]methyl]-N-methylbutane-1,4-diamine
N'-[[(1S,2S)-2-[[4-(ethylamino)butylamino]methyl]cyclopropyl]methyl]-N-methylbutane-1,4-diamine (PubChem CID 71064547) has the molecular formula C16H36N4
and a molecular weight of 284.49 g/mol. Its IUPAC name is N'-[[(1S,2S)-2-[[4-(ethylamino)butylamino]methyl]cyclopropyl]methyl]-N-methylbutane-1,4-diamine.
Molecular Properties
| Compound Name | N'-[[(1S,2S)-2-[[4-(ethylamino)butylamino]methyl]cyclopropyl]methyl]-N-methylbutane-1,4-diamine |
| PubChem CID | 71064547 |
| Molecular Formula | C16H36N4 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.29 |
| IUPAC Name | N'-[[(1S,2S)-2-[[4-(ethylamino)butylamino]methyl]cyclopropyl]methyl]-N-methylbutane-1,4-diamine |
| SMILES | CCNCCCCNC[C@H]1C[C@@H]1CNCCCCNC |
| InChI | InChI=1S/C16H36N4/c1-3-18-9-6-7-11-20-14-16-12-15(16)13-19-10-5-4-8-17-2/h15-20H,3-14H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | HDKMFDLPEHBQMU-HZPDHXFCSA-N |
| XLogP | 1.19 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[[(1S,2S)-2-[[4-(ethylamino)butylamino]methyl]cyclopropyl]methyl]-N-methylbutane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[(1S,2S)-2-[[4-(ethylamino)butylamino]methyl]cyclopropyl]methyl]-N-methylbutane-1,4-diamine?
The IUPAC name of N'-[[(1S,2S)-2-[[4-(ethylamino)butylamino]methyl]cyclopropyl]methyl]-N-methylbutane-1,4-diamine (CID 71064547) is N'-[[(1S,2S)-2-[[4-(ethylamino)butylamino]methyl]cyclopropyl]methyl]-N-methylbutane-1,4-diamine.
What is the SMILES notation for N'-[[(1S,2S)-2-[[4-(ethylamino)butylamino]methyl]cyclopropyl]methyl]-N-methylbutane-1,4-diamine?
The canonical SMILES for N'-[[(1S,2S)-2-[[4-(ethylamino)butylamino]methyl]cyclopropyl]methyl]-N-methylbutane-1,4-diamine is CCNCCCCNC[C@H]1C[C@@H]1CNCCCCNC.
What is the InChIKey of N'-[[(1S,2S)-2-[[4-(ethylamino)butylamino]methyl]cyclopropyl]methyl]-N-methylbutane-1,4-diamine?
The InChIKey is HDKMFDLPEHBQMU-HZPDHXFCSA-N. The full InChI is InChI=1S/C16H36N4/c1-3-18-9-6-7-11-20-14-16-12-15(16)13-19-10-5-4-8-17-2/h15-20H,3-14H2,1-2H3/t15-,16-/m1/s1.
What are the key properties of N'-[[(1S,2S)-2-[[4-(ethylamino)butylamino]methyl]cyclopropyl]methyl]-N-methylbutane-1,4-diamine?
N'-[[(1S,2S)-2-[[4-(ethylamino)butylamino]methyl]cyclopropyl]methyl]-N-methylbutane-1,4-diamine has a molecular weight of 284.49 g/mol, XLogP of 1.19, 15 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[(1S,2S)-2-[[4-(ethylamino)butylamino]methyl]cyclopropyl]methyl]-N-methylbutane-1,4-diamine is sourced from PubChem (CID 71064547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).