C20H20F4N6O2 — CID 71064678
(2R)-1-[2-[5-(2,5-dihydropyrrole-1-carbonyl)-2,3-dihydro-1H-pyrrol-3-yl]-5-fluoropyrimidin-4-yl]-N-(2,2,2-trifluoroethyl)-2,3-dihydropyrrole-2-carboxamide (PubChem CID 71064678) has the molecular formula C20H20F4N6O2 and a molecular weight of 452.41 g/mol. Its IUPAC name is (2R)-1-[2-[5-(2,5-dihydropyrrole-1-carbonyl)-2,3-dihydro-1H-pyrrol-3-yl]-5-fluoropyrimidin-4-yl]-N-(2,2,2-trifluoroethyl)-2,3-dihydropyrrole-2-carboxamide.
| Compound Name | (2R)-1-[2-[5-(2,5-dihydropyrrole-1-carbonyl)-2,3-dihydro-1H-pyrrol-3-yl]-5-fluoropyrimidin-4-yl]-N-(2,2,2-trifluoroethyl)-2,3-dihydropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 71064678 |
| Molecular Formula | C20H20F4N6O2 |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | (2R)-1-[2-[5-(2,5-dihydropyrrole-1-carbonyl)-2,3-dihydro-1H-pyrrol-3-yl]-5-fluoropyrimidin-4-yl]-N-(2,2,2-trifluoroethyl)-2,3-dihydropyrrole-2-carboxamide |
| SMILES | O=C(NCC(F)(F)F)[C@H]1CC=CN1c1nc(C2C=C(C(=O)N3CC=CC3)NC2)ncc1F |
| InChI | InChI=1S/C20H20F4N6O2/c21-13-10-26-16(12-8-14(25-9-12)19(32)29-5-1-2-6-29)28-17(13)30-7-3-4-15(30)18(31)27-11-20(22,23)24/h1-3,7-8,10,12,15,25H,4-6,9,11H2,(H,27,31)/t12?,15-/m1/s1 |
| InChIKey | ANESBKRRSWGQSP-WPZCJLIBSA-N |
| XLogP | 1.36 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|