C26H38N4O2 — CID 71064801
(2S)-2-(methylamino)-N-[(1S,7S,10R,14R)-8-oxo-12-(2-phenylethyl)-9,12-diazatetracyclo[7.5.1.01,6.010,14]pentadecan-7-yl]butanamide (PubChem CID 71064801) has the molecular formula C26H38N4O2 and a molecular weight of 438.62 g/mol. Its IUPAC name is (2S)-2-(methylamino)-N-[(1S,7S,10R,14R)-8-oxo-12-(2-phenylethyl)-9,12-diazatetracyclo[7.5.1.01,6.010,14]pentadecan-7-yl]butanamide.
| Compound Name | (2S)-2-(methylamino)-N-[(1S,7S,10R,14R)-8-oxo-12-(2-phenylethyl)-9,12-diazatetracyclo[7.5.1.01,6.010,14]pentadecan-7-yl]butanamide |
|---|---|
| PubChem CID | 71064801 |
| Molecular Formula | C26H38N4O2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (2S)-2-(methylamino)-N-[(1S,7S,10R,14R)-8-oxo-12-(2-phenylethyl)-9,12-diazatetracyclo[7.5.1.01,6.010,14]pentadecan-7-yl]butanamide |
| SMILES | CC[C@H](NC)C(=O)N[C@@H]1C(=O)N2C[C@]3(CCCCC13)[C@@H]1CN(CCc3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C26H38N4O2/c1-3-21(27-2)24(31)28-23-19-11-7-8-13-26(19)17-30(25(23)32)22-16-29(15-20(22)26)14-12-18-9-5-4-6-10-18/h4-6,9-10,19-23,27H,3,7-8,11-17H2,1-2H3,(H,28,31)/t19?,20-,21+,22+,23+,26+/m1/s1 |
| InChIKey | KEYBHYIVDCWINQ-HGSGMAOVSA-N |
| XLogP | 2.04 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |