About 6,8-dimethyl-3-(2-oxopropyl)imidazo[1,2-c]pyrimidin-5-one
6,8-dimethyl-3-(2-oxopropyl)imidazo[1,2-c]pyrimidin-5-one (PubChem CID 71064826) has the molecular formula C11H13N3O2
and a molecular weight of 219.24 g/mol. Its IUPAC name is 6,8-dimethyl-3-(2-oxopropyl)imidazo[1,2-c]pyrimidin-5-one.
Molecular Properties
| Compound Name | 6,8-dimethyl-3-(2-oxopropyl)imidazo[1,2-c]pyrimidin-5-one |
| PubChem CID | 71064826 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 6,8-dimethyl-3-(2-oxopropyl)imidazo[1,2-c]pyrimidin-5-one |
| SMILES | CC(=O)Cc1cnc2c(C)cn(C)c(=O)n12 |
| InChI | InChI=1S/C11H13N3O2/c1-7-6-13(3)11(16)14-9(4-8(2)15)5-12-10(7)14/h5-6H,4H2,1-3H3 |
| InChIKey | VOOHOLNFUKTQSJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 56.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6,8-dimethyl-3-(2-oxopropyl)imidazo[1,2-c]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dimethyl-3-(2-oxopropyl)imidazo[1,2-c]pyrimidin-5-one?
The IUPAC name of 6,8-dimethyl-3-(2-oxopropyl)imidazo[1,2-c]pyrimidin-5-one (CID 71064826) is 6,8-dimethyl-3-(2-oxopropyl)imidazo[1,2-c]pyrimidin-5-one.
What is the SMILES notation for 6,8-dimethyl-3-(2-oxopropyl)imidazo[1,2-c]pyrimidin-5-one?
The canonical SMILES for 6,8-dimethyl-3-(2-oxopropyl)imidazo[1,2-c]pyrimidin-5-one is CC(=O)Cc1cnc2c(C)cn(C)c(=O)n12.
What is the InChIKey of 6,8-dimethyl-3-(2-oxopropyl)imidazo[1,2-c]pyrimidin-5-one?
The InChIKey is VOOHOLNFUKTQSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c1-7-6-13(3)11(16)14-9(4-8(2)15)5-12-10(7)14/h5-6H,4H2,1-3H3.
What are the key properties of 6,8-dimethyl-3-(2-oxopropyl)imidazo[1,2-c]pyrimidin-5-one?
6,8-dimethyl-3-(2-oxopropyl)imidazo[1,2-c]pyrimidin-5-one has a molecular weight of 219.24 g/mol, XLogP of 0.47, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dimethyl-3-(2-oxopropyl)imidazo[1,2-c]pyrimidin-5-one is sourced from PubChem (CID 71064826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).