About (2Z)-2-[(2S)-2-pentyl-2,3-dihydro-1H-pyridin-6-ylidene]-1H-pyrazine
(2Z)-2-[(2S)-2-pentyl-2,3-dihydro-1H-pyridin-6-ylidene]-1H-pyrazine (PubChem CID 71065143) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is (2Z)-2-[(2S)-2-pentyl-2,3-dihydro-1H-pyridin-6-ylidene]-1H-pyrazine.
Molecular Properties
| Compound Name | (2Z)-2-[(2S)-2-pentyl-2,3-dihydro-1H-pyridin-6-ylidene]-1H-pyrazine |
| PubChem CID | 71065143 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (2Z)-2-[(2S)-2-pentyl-2,3-dihydro-1H-pyridin-6-ylidene]-1H-pyrazine |
| SMILES | CCCCC[C@H]1CC=C/C(=C2\C=NC=CN2)N1 |
| InChI | InChI=1S/C14H21N3/c1-2-3-4-6-12-7-5-8-13(17-12)14-11-15-9-10-16-14/h5,8-12,16-17H,2-4,6-7H2,1H3/b14-13-/t12-/m0/s1 |
| InChIKey | RPTVEGGWCDBDMS-JOLOJFPGSA-N |
| XLogP | 2.84 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[(2S)-2-pentyl-2,3-dihydro-1H-pyridin-6-ylidene]-1H-pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[(2S)-2-pentyl-2,3-dihydro-1H-pyridin-6-ylidene]-1H-pyrazine?
The IUPAC name of (2Z)-2-[(2S)-2-pentyl-2,3-dihydro-1H-pyridin-6-ylidene]-1H-pyrazine (CID 71065143) is (2Z)-2-[(2S)-2-pentyl-2,3-dihydro-1H-pyridin-6-ylidene]-1H-pyrazine.
What is the SMILES notation for (2Z)-2-[(2S)-2-pentyl-2,3-dihydro-1H-pyridin-6-ylidene]-1H-pyrazine?
The canonical SMILES for (2Z)-2-[(2S)-2-pentyl-2,3-dihydro-1H-pyridin-6-ylidene]-1H-pyrazine is CCCCC[C@H]1CC=C/C(=C2\C=NC=CN2)N1.
What is the InChIKey of (2Z)-2-[(2S)-2-pentyl-2,3-dihydro-1H-pyridin-6-ylidene]-1H-pyrazine?
The InChIKey is RPTVEGGWCDBDMS-JOLOJFPGSA-N. The full InChI is InChI=1S/C14H21N3/c1-2-3-4-6-12-7-5-8-13(17-12)14-11-15-9-10-16-14/h5,8-12,16-17H,2-4,6-7H2,1H3/b14-13-/t12-/m0/s1.
What are the key properties of (2Z)-2-[(2S)-2-pentyl-2,3-dihydro-1H-pyridin-6-ylidene]-1H-pyrazine?
(2Z)-2-[(2S)-2-pentyl-2,3-dihydro-1H-pyridin-6-ylidene]-1H-pyrazine has a molecular weight of 231.34 g/mol, XLogP of 2.84, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[(2S)-2-pentyl-2,3-dihydro-1H-pyridin-6-ylidene]-1H-pyrazine is sourced from PubChem (CID 71065143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).