C18H28FNO5Si — CID 71065496
(2S,3S)-3-(fluoromethyl)-5-[hydroxy(dimethyl)silyl]-5-methyl-2-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 71065496) has the molecular formula C18H28FNO5Si and a molecular weight of 385.51 g/mol. Its IUPAC name is (2S,3S)-3-(fluoromethyl)-5-[hydroxy(dimethyl)silyl]-5-methyl-2-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2S,3S)-3-(fluoromethyl)-5-[hydroxy(dimethyl)silyl]-5-methyl-2-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 71065496 |
| Molecular Formula | C18H28FNO5Si |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (2S,3S)-3-(fluoromethyl)-5-[hydroxy(dimethyl)silyl]-5-methyl-2-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | CC(C)(C[C@H](CF)[C@H](NC(=O)OCc1ccccc1)C(=O)O)[Si](C)(C)O |
| InChI | InChI=1S/C18H28FNO5Si/c1-18(2,26(3,4)24)10-14(11-19)15(16(21)22)20-17(23)25-12-13-8-6-5-7-9-13/h5-9,14-15,24H,10-12H2,1-4H3,(H,20,23)(H,21,22)/t14-,15+/m1/s1 |
| InChIKey | DHJIUTZEQARKGQ-CABCVRRESA-N |
| XLogP | 3.32 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|