About 8-fluoro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene
8-fluoro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene (PubChem CID 71065566) has the molecular formula C10H8F4O
and a molecular weight of 220.16 g/mol. Its IUPAC name is 8-fluoro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene.
Analyze 8-fluoro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene?
The IUPAC name of 8-fluoro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene (CID 71065566) is 8-fluoro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene.
What is the SMILES notation for 8-fluoro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene?
The canonical SMILES for 8-fluoro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene is Fc1c(C(F)(F)F)ccc2c1OCCC2.
What is the InChIKey of 8-fluoro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene?
The InChIKey is WJVRQTNNENEYCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F4O/c11-8-7(10(12,13)14)4-3-6-2-1-5-15-9(6)8/h3-4H,1-2,5H2.
What are the key properties of 8-fluoro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene?
8-fluoro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene has a molecular weight of 220.16 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-7-(trifluoromethyl)-3,4-dihydro-2H-chromene is sourced from PubChem (CID 71065566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).