About N-[1-(4-ethylcyclohexa-1,3-diene-1-carbonyl)pyrrolidin-3-yl]acetamide
N-[1-(4-ethylcyclohexa-1,3-diene-1-carbonyl)pyrrolidin-3-yl]acetamide (PubChem CID 71065612) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is N-[1-(4-ethylcyclohexa-1,3-diene-1-carbonyl)pyrrolidin-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[1-(4-ethylcyclohexa-1,3-diene-1-carbonyl)pyrrolidin-3-yl]acetamide |
| PubChem CID | 71065612 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-[1-(4-ethylcyclohexa-1,3-diene-1-carbonyl)pyrrolidin-3-yl]acetamide |
| SMILES | CCC1=CC=C(C(=O)N2CCC(NC(C)=O)C2)CC1 |
| InChI | InChI=1S/C15H22N2O2/c1-3-12-4-6-13(7-5-12)15(19)17-9-8-14(10-17)16-11(2)18/h4,6,14H,3,5,7-10H2,1-2H3,(H,16,18) |
| InChIKey | JDTLEAWSUYHHND-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-(4-ethylcyclohexa-1,3-diene-1-carbonyl)pyrrolidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-ethylcyclohexa-1,3-diene-1-carbonyl)pyrrolidin-3-yl]acetamide?
The IUPAC name of N-[1-(4-ethylcyclohexa-1,3-diene-1-carbonyl)pyrrolidin-3-yl]acetamide (CID 71065612) is N-[1-(4-ethylcyclohexa-1,3-diene-1-carbonyl)pyrrolidin-3-yl]acetamide.
What is the SMILES notation for N-[1-(4-ethylcyclohexa-1,3-diene-1-carbonyl)pyrrolidin-3-yl]acetamide?
The canonical SMILES for N-[1-(4-ethylcyclohexa-1,3-diene-1-carbonyl)pyrrolidin-3-yl]acetamide is CCC1=CC=C(C(=O)N2CCC(NC(C)=O)C2)CC1.
What is the InChIKey of N-[1-(4-ethylcyclohexa-1,3-diene-1-carbonyl)pyrrolidin-3-yl]acetamide?
The InChIKey is JDTLEAWSUYHHND-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-3-12-4-6-13(7-5-12)15(19)17-9-8-14(10-17)16-11(2)18/h4,6,14H,3,5,7-10H2,1-2H3,(H,16,18).
What are the key properties of N-[1-(4-ethylcyclohexa-1,3-diene-1-carbonyl)pyrrolidin-3-yl]acetamide?
N-[1-(4-ethylcyclohexa-1,3-diene-1-carbonyl)pyrrolidin-3-yl]acetamide has a molecular weight of 262.35 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-ethylcyclohexa-1,3-diene-1-carbonyl)pyrrolidin-3-yl]acetamide is sourced from PubChem (CID 71065612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).