C33H51N3O2 — CID 71065864
(6R)-18-amino-12-ethyl-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid (PubChem CID 71065864) has the molecular formula C33H51N3O2 and a molecular weight of 521.79 g/mol. Its IUPAC name is (6R)-18-amino-12-ethyl-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid.
| Compound Name | (6R)-18-amino-12-ethyl-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
|---|---|
| PubChem CID | 71065864 |
| Molecular Formula | C33H51N3O2 |
| Molecular Weight | 521.79 g/mol |
| Exact Mass | 521.40 |
| IUPAC Name | (6R)-18-amino-12-ethyl-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
| SMILES | CCC1=C2C3CC(C)(C)C[C@@H](C(=O)O)C3CCC2(C)C2(C)CCC3C(C)(C)c4[nH]nc(N)c4CC3(C)C2C1 |
| InChI | InChI=1S/C33H51N3O2/c1-9-18-14-24-31(6)17-22-26(35-36-27(22)34)30(4,5)23(31)11-13-32(24,7)33(8)12-10-19-20(25(18)33)15-29(2,3)16-21(19)28(37)38/h19-21,23-24H,9-17H2,1-8H3,(H,37,38)(H3,34,35,36)/t19?,20?,21-,23?,24?,31?,32?,33?/m1/s1 |
| InChIKey | HQPLTMLARLNMQA-JVEDAFSXSA-N |
| XLogP | 7.53 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.79 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|