C41H58N4O3 — CID 71065894
(6R)-18-amino-1,2,8,8,15,22,22-heptamethyl-12-(4-morpholin-4-ylphenyl)-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid (PubChem CID 71065894) has the molecular formula C41H58N4O3 and a molecular weight of 654.94 g/mol. Its IUPAC name is (6R)-18-amino-1,2,8,8,15,22,22-heptamethyl-12-(4-morpholin-4-ylphenyl)-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid.
| Compound Name | (6R)-18-amino-1,2,8,8,15,22,22-heptamethyl-12-(4-morpholin-4-ylphenyl)-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
|---|---|
| PubChem CID | 71065894 |
| Molecular Formula | C41H58N4O3 |
| Molecular Weight | 654.94 g/mol |
| Exact Mass | 654.45 |
| IUPAC Name | (6R)-18-amino-1,2,8,8,15,22,22-heptamethyl-12-(4-morpholin-4-ylphenyl)-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
| SMILES | CC1(C)CC2C3=C(c4ccc(N5CCOCC5)cc4)CC4C5(C)Cc6c(N)n[nH]c6C(C)(C)C5CCC4(C)C3(C)CCC2[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C41H58N4O3/c1-37(2)21-28-26(29(22-37)36(46)47)12-14-41(7)33(28)27(24-8-10-25(11-9-24)45-16-18-48-19-17-45)20-32-39(5)23-30-34(43-44-35(30)42)38(3,4)31(39)13-15-40(32,41)6/h8-11,26,28-29,31-32H,12-23H2,1-7H3,(H,46,47)(H3,42,43,44)/t26?,28?,29-,31?,32?,39?,40?,41?/m1/s1 |
| InChIKey | NVVSAEGNSCMVCQ-JSBFUYDASA-N |
| XLogP | 8.11 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.94 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|