C35H49N3O3 — CID 71065979
(1R,2S,5S,6R,15R)-18-amino-12-(furan-2-yl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid (PubChem CID 71065979) has the molecular formula C35H49N3O3 and a molecular weight of 559.80 g/mol. Its IUPAC name is (1R,2S,5S,6R,15R)-18-amino-12-(furan-2-yl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid.
| Compound Name | (1R,2S,5S,6R,15R)-18-amino-12-(furan-2-yl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
|---|---|
| PubChem CID | 71065979 |
| Molecular Formula | C35H49N3O3 |
| Molecular Weight | 559.80 g/mol |
| Exact Mass | 559.38 |
| IUPAC Name | (1R,2S,5S,6R,15R)-18-amino-12-(furan-2-yl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
| SMILES | CC1(C)CC2C3=C(c4ccco4)CC4[C@@]5(C)Cc6c(N)n[nH]c6C(C)(C)C5CC[C@@]4(C)[C@]3(C)CC[C@@H]2[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C35H49N3O3/c1-31(2)16-21-19(22(17-31)30(39)40)10-12-35(7)27(21)20(24-9-8-14-41-24)15-26-33(5)18-23-28(37-38-29(23)36)32(3,4)25(33)11-13-34(26,35)6/h8-9,14,19,21-22,25-26H,10-13,15-18H2,1-7H3,(H,39,40)(H3,36,37,38)/t19-,21?,22+,25?,26?,33-,34+,35+/m0/s1 |
| InChIKey | FVMCWMFBMLGVDU-RNNLKIOFSA-N |
| XLogP | 7.87 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.80 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |