C37H50FN3O2 — CID 71066061
(6R)-18-amino-12-(3-fluorophenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid (PubChem CID 71066061) has the molecular formula C37H50FN3O2 and a molecular weight of 587.82 g/mol. Its IUPAC name is (6R)-18-amino-12-(3-fluorophenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid.
| Compound Name | (6R)-18-amino-12-(3-fluorophenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
|---|---|
| PubChem CID | 71066061 |
| Molecular Formula | C37H50FN3O2 |
| Molecular Weight | 587.82 g/mol |
| Exact Mass | 587.39 |
| IUPAC Name | (6R)-18-amino-12-(3-fluorophenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
| SMILES | CC1(C)CC2C3=C(c4cccc(F)c4)CC4C5(C)Cc6c(N)n[nH]c6C(C)(C)C5CCC4(C)C3(C)CCC2[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C37H50FN3O2/c1-33(2)17-24-22(25(18-33)32(42)43)11-13-37(7)29(24)23(20-9-8-10-21(38)15-20)16-28-35(5)19-26-30(40-41-31(26)39)34(3,4)27(35)12-14-36(28,37)6/h8-10,15,22,24-25,27-28H,11-14,16-19H2,1-7H3,(H,42,43)(H3,39,40,41)/t22?,24?,25-,27?,28?,35?,36?,37?/m1/s1 |
| InChIKey | AGPZQGPMXXFOBR-FXKVYGGKSA-N |
| XLogP | 8.41 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.82 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |