C37H51N3O3 — CID 71066065
(1R,2S,5S,6R,15R)-18-amino-12-(3-hydroxyphenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid (PubChem CID 71066065) has the molecular formula C37H51N3O3 and a molecular weight of 585.83 g/mol. Its IUPAC name is (1R,2S,5S,6R,15R)-18-amino-12-(3-hydroxyphenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid.
| Compound Name | (1R,2S,5S,6R,15R)-18-amino-12-(3-hydroxyphenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
|---|---|
| PubChem CID | 71066065 |
| Molecular Formula | C37H51N3O3 |
| Molecular Weight | 585.83 g/mol |
| Exact Mass | 585.39 |
| IUPAC Name | (1R,2S,5S,6R,15R)-18-amino-12-(3-hydroxyphenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
| SMILES | CC1(C)CC2C3=C(c4cccc(O)c4)CC4[C@@]5(C)Cc6c(N)n[nH]c6C(C)(C)C5CC[C@@]4(C)[C@]3(C)CC[C@@H]2[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C37H51N3O3/c1-33(2)17-24-22(25(18-33)32(42)43)11-13-37(7)29(24)23(20-9-8-10-21(41)15-20)16-28-35(5)19-26-30(39-40-31(26)38)34(3,4)27(35)12-14-36(28,37)6/h8-10,15,22,24-25,27-28,41H,11-14,16-19H2,1-7H3,(H,42,43)(H3,38,39,40)/t22-,24?,25+,27?,28?,35-,36+,37+/m0/s1 |
| InChIKey | SJJWOBGFBCQNGN-AREIZPQFSA-N |
| XLogP | 7.98 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.83 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |