C31H43NO8 — CID 71066115
(1S,3S,4R,8S,9R,12R,14R,16S)-9-ethyl-8,12,14-trimethyl-3-(phenylmethoxymethyl)-16-propyl-7,10,17-trioxa-5-azatricyclo[14.2.1.04,8]nonadecane-2,6,11,13-tetrone (PubChem CID 71066115) has the molecular formula C31H43NO8 and a molecular weight of 557.68 g/mol. Its IUPAC name is (1S,3S,4R,8S,9R,12R,14R,16S)-9-ethyl-8,12,14-trimethyl-3-(phenylmethoxymethyl)-16-propyl-7,10,17-trioxa-5-azatricyclo[14.2.1.04,8]nonadecane-2,6,11,13-tetrone.
| Compound Name | (1S,3S,4R,8S,9R,12R,14R,16S)-9-ethyl-8,12,14-trimethyl-3-(phenylmethoxymethyl)-16-propyl-7,10,17-trioxa-5-azatricyclo[14.2.1.04,8]nonadecane-2,6,11,13-tetrone |
|---|---|
| PubChem CID | 71066115 |
| Molecular Formula | C31H43NO8 |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | (1S,3S,4R,8S,9R,12R,14R,16S)-9-ethyl-8,12,14-trimethyl-3-(phenylmethoxymethyl)-16-propyl-7,10,17-trioxa-5-azatricyclo[14.2.1.04,8]nonadecane-2,6,11,13-tetrone |
| SMILES | CCC[C@]12C[C@@H](CO1)C(=O)[C@H](COCc1ccccc1)[C@H]1NC(=O)O[C@]1(C)[C@@H](CC)OC(=O)[C@H](C)C(=O)[C@H](C)C2 |
| InChI | InChI=1S/C31H43NO8/c1-6-13-31-14-19(3)25(33)20(4)28(35)39-24(7-2)30(5)27(32-29(36)40-30)23(26(34)22(15-31)17-38-31)18-37-16-21-11-9-8-10-12-21/h8-12,19-20,22-24,27H,6-7,13-18H2,1-5H3,(H,32,36)/t19-,20-,22+,23+,24-,27-,30-,31+/m1/s1 |
| InChIKey | WLHVWVITARVTQQ-DACVDBIQSA-N |
| XLogP | 4.40 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|