About 1-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methyl]piperazine
1-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methyl]piperazine (PubChem CID 71066428) has the molecular formula C15H22FN5O
and a molecular weight of 307.37 g/mol. Its IUPAC name is 1-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methyl]piperazine.
Molecular Properties
| Compound Name | 1-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methyl]piperazine |
| PubChem CID | 71066428 |
| Molecular Formula | C15H22FN5O |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 1-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methyl]piperazine |
| SMILES | CO[C@H](c1ccc(CN2CCNCC2)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C15H22FN5O/c1-22-15(14(10-16)19-20-17)13-4-2-12(3-5-13)11-21-8-6-18-7-9-21/h2-5,14-15,18H,6-11H2,1H3/t14-,15-/m1/s1 |
| InChIKey | FGLRFGWZYQSMQE-HUUCEWRRSA-N |
| XLogP | 2.43 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methyl]piperazine?
The IUPAC name of 1-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methyl]piperazine (CID 71066428) is 1-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methyl]piperazine.
What is the SMILES notation for 1-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methyl]piperazine?
The canonical SMILES for 1-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methyl]piperazine is CO[C@H](c1ccc(CN2CCNCC2)cc1)[C@@H](CF)N=[N+]=[N-].
What is the InChIKey of 1-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methyl]piperazine?
The InChIKey is FGLRFGWZYQSMQE-HUUCEWRRSA-N. The full InChI is InChI=1S/C15H22FN5O/c1-22-15(14(10-16)19-20-17)13-4-2-12(3-5-13)11-21-8-6-18-7-9-21/h2-5,14-15,18H,6-11H2,1H3/t14-,15-/m1/s1.
What are the key properties of 1-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methyl]piperazine?
1-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methyl]piperazine has a molecular weight of 307.37 g/mol, XLogP of 2.43, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methyl]piperazine is sourced from PubChem (CID 71066428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).