About 3-amino-4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]cyclobut-3-ene-1,2-dione
3-amino-4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]cyclobut-3-ene-1,2-dione (PubChem CID 71066513) has the molecular formula C14H13FN4O3
and a molecular weight of 304.28 g/mol. Its IUPAC name is 3-amino-4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]cyclobut-3-ene-1,2-dione.
Molecular Properties
| Compound Name | 3-amino-4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]cyclobut-3-ene-1,2-dione |
| PubChem CID | 71066513 |
| Molecular Formula | C14H13FN4O3 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3-amino-4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]cyclobut-3-ene-1,2-dione |
| SMILES | CO[C@H](c1ccc(-c2c(N)c(=O)c2=O)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C14H13FN4O3/c1-22-14(9(6-15)18-19-17)8-4-2-7(3-5-8)10-11(16)13(21)12(10)20/h2-5,9,14H,6,16H2,1H3/t9-,14-/m1/s1 |
| InChIKey | ZDNWVTVTEAEWEN-YMTOWFKASA-N |
| XLogP | 1.87 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]cyclobut-3-ene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]cyclobut-3-ene-1,2-dione?
The IUPAC name of 3-amino-4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]cyclobut-3-ene-1,2-dione (CID 71066513) is 3-amino-4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]cyclobut-3-ene-1,2-dione.
What is the SMILES notation for 3-amino-4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]cyclobut-3-ene-1,2-dione?
The canonical SMILES for 3-amino-4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]cyclobut-3-ene-1,2-dione is CO[C@H](c1ccc(-c2c(N)c(=O)c2=O)cc1)[C@@H](CF)N=[N+]=[N-].
What is the InChIKey of 3-amino-4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]cyclobut-3-ene-1,2-dione?
The InChIKey is ZDNWVTVTEAEWEN-YMTOWFKASA-N. The full InChI is InChI=1S/C14H13FN4O3/c1-22-14(9(6-15)18-19-17)8-4-2-7(3-5-8)10-11(16)13(21)12(10)20/h2-5,9,14H,6,16H2,1H3/t9-,14-/m1/s1.
What are the key properties of 3-amino-4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]cyclobut-3-ene-1,2-dione?
3-amino-4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]cyclobut-3-ene-1,2-dione has a molecular weight of 304.28 g/mol, XLogP of 1.87, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]cyclobut-3-ene-1,2-dione is sourced from PubChem (CID 71066513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).