About 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine
2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine (PubChem CID 71066520) has the molecular formula C14H19FN4O
and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine.
Molecular Properties
| Compound Name | 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine |
| PubChem CID | 71066520 |
| Molecular Formula | C14H19FN4O |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine |
| SMILES | CO[C@H](c1ccc(C2CCCN2)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C14H19FN4O/c1-20-14(13(9-15)18-19-16)11-6-4-10(5-7-11)12-3-2-8-17-12/h4-7,12-14,17H,2-3,8-9H2,1H3/t12?,13-,14-/m1/s1 |
| InChIKey | SPASIHAUEFIPMC-ILMHWDKJSA-N |
| XLogP | 3.45 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine?
The IUPAC name of 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine (CID 71066520) is 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine.
What is the SMILES notation for 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine?
The canonical SMILES for 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine is CO[C@H](c1ccc(C2CCCN2)cc1)[C@@H](CF)N=[N+]=[N-].
What is the InChIKey of 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine?
The InChIKey is SPASIHAUEFIPMC-ILMHWDKJSA-N. The full InChI is InChI=1S/C14H19FN4O/c1-20-14(13(9-15)18-19-16)11-6-4-10(5-7-11)12-3-2-8-17-12/h4-7,12-14,17H,2-3,8-9H2,1H3/t12?,13-,14-/m1/s1.
What are the key properties of 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine?
2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine has a molecular weight of 278.33 g/mol, XLogP of 3.45, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine is sourced from PubChem (CID 71066520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).