C15H20FN5O2 — CID 71066530
(2R)-N-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 71066530) has the molecular formula C15H20FN5O2 and a molecular weight of 321.36 g/mol. Its IUPAC name is (2R)-N-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 71066530 |
| Molecular Formula | C15H20FN5O2 |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (2R)-N-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | CO[C@H](c1ccc(NC(=O)[C@H]2CCCN2)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C15H20FN5O2/c1-23-14(13(9-16)20-21-17)10-4-6-11(7-5-10)19-15(22)12-3-2-8-18-12/h4-7,12-14,18H,2-3,8-9H2,1H3,(H,19,22)/t12-,13-,14-/m1/s1 |
| InChIKey | GASQTTVLOFORAB-MGPQQGTHSA-N |
| XLogP | 2.71 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|