C14H18FN5O — CID 71066546
2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1,4,5,6-tetrahydropyrimidine (PubChem CID 71066546) has the molecular formula C14H18FN5O and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 71066546 |
| Molecular Formula | C14H18FN5O |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1,4,5,6-tetrahydropyrimidine |
| SMILES | CO[C@H](c1ccc(C2=NCCCN2)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C14H18FN5O/c1-21-13(12(9-15)19-20-16)10-3-5-11(6-4-10)14-17-7-2-8-18-14/h3-6,12-13H,2,7-9H2,1H3,(H,17,18)/t12-,13-/m1/s1 |
| InChIKey | XNGNSXIVOINHGC-CHWSQXEVSA-N |
| XLogP | 2.76 |
| TPSA | 82.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|