About 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-4,5-dihydroimidazole
2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-4,5-dihydroimidazole (PubChem CID 71066561) has the molecular formula C14H18FN5O
and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-4,5-dihydroimidazole |
| PubChem CID | 71066561 |
| Molecular Formula | C14H18FN5O |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-4,5-dihydroimidazole |
| SMILES | CO[C@H](c1ccc(C2=NCCN2C)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C14H18FN5O/c1-20-8-7-17-14(20)11-5-3-10(4-6-11)13(21-2)12(9-15)18-19-16/h3-6,12-13H,7-9H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | WAUGDFQQPBBEKF-CHWSQXEVSA-N |
| XLogP | 2.71 |
| TPSA | 73.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-4,5-dihydroimidazole?
The IUPAC name of 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-4,5-dihydroimidazole (CID 71066561) is 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-4,5-dihydroimidazole.
What is the SMILES notation for 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-4,5-dihydroimidazole?
The canonical SMILES for 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-4,5-dihydroimidazole is CO[C@H](c1ccc(C2=NCCN2C)cc1)[C@@H](CF)N=[N+]=[N-].
What is the InChIKey of 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-4,5-dihydroimidazole?
The InChIKey is WAUGDFQQPBBEKF-CHWSQXEVSA-N. The full InChI is InChI=1S/C14H18FN5O/c1-20-8-7-17-14(20)11-5-3-10(4-6-11)13(21-2)12(9-15)18-19-16/h3-6,12-13H,7-9H2,1-2H3/t12-,13-/m1/s1.
What are the key properties of 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-4,5-dihydroimidazole?
2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-4,5-dihydroimidazole has a molecular weight of 291.33 g/mol, XLogP of 2.71, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-4,5-dihydroimidazole is sourced from PubChem (CID 71066561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).