C21H28N6O3S — CID 71066735
N-[2-[4-amino-1-[2-(2,2-dimethylpropylamino)ethyl]imidazo[4,5-c]pyridin-2-yl]sulfanyl-4,5-dihydroxyphenyl]acetamide (PubChem CID 71066735) has the molecular formula C21H28N6O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-[2-[4-amino-1-[2-(2,2-dimethylpropylamino)ethyl]imidazo[4,5-c]pyridin-2-yl]sulfanyl-4,5-dihydroxyphenyl]acetamide.
| Compound Name | N-[2-[4-amino-1-[2-(2,2-dimethylpropylamino)ethyl]imidazo[4,5-c]pyridin-2-yl]sulfanyl-4,5-dihydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 71066735 |
| Molecular Formula | C21H28N6O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-[2-[4-amino-1-[2-(2,2-dimethylpropylamino)ethyl]imidazo[4,5-c]pyridin-2-yl]sulfanyl-4,5-dihydroxyphenyl]acetamide |
| SMILES | CC(=O)Nc1cc(O)c(O)cc1Sc1nc2c(N)nccc2n1CCNCC(C)(C)C |
| InChI | InChI=1S/C21H28N6O3S/c1-12(28)25-13-9-15(29)16(30)10-17(13)31-20-26-18-14(5-6-24-19(18)22)27(20)8-7-23-11-21(2,3)4/h5-6,9-10,23,29-30H,7-8,11H2,1-4H3,(H2,22,24)(H,25,28) |
| InChIKey | SAOYQVMKNUXJGL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|