About 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,3-diol
5-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,3-diol (PubChem CID 71066905) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,3-diol.
Molecular Properties
| Compound Name | 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,3-diol |
| PubChem CID | 71066905 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,3-diol |
| SMILES | CC(C)NCC(O)C1=CC(O)CC(O)=C1 |
| InChI | InChI=1S/C11H19NO3/c1-7(2)12-6-11(15)8-3-9(13)5-10(14)4-8/h3-4,7,9,11-15H,5-6H2,1-2H3 |
| InChIKey | KZRUHECGYJVIPP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,3-diol?
The IUPAC name of 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,3-diol (CID 71066905) is 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,3-diol.
What is the SMILES notation for 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,3-diol?
The canonical SMILES for 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,3-diol is CC(C)NCC(O)C1=CC(O)CC(O)=C1.
What is the InChIKey of 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,3-diol?
The InChIKey is KZRUHECGYJVIPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-7(2)12-6-11(15)8-3-9(13)5-10(14)4-8/h3-4,7,9,11-15H,5-6H2,1-2H3.
What are the key properties of 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,3-diol?
5-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,3-diol has a molecular weight of 213.28 g/mol, XLogP of 0.48, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,3-diol is sourced from PubChem (CID 71066905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).